C7H20N4 — CID 134341698
1-N'-methyl-1-N'-[1-(2-methylhydrazinyl)propan-2-yl]ethane-1,1-diamine (PubChem CID 134341698) has the molecular formula C7H20N4 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-N'-methyl-1-N'-[1-(2-methylhydrazinyl)propan-2-yl]ethane-1,1-diamine.
| Compound Name | 1-N'-methyl-1-N'-[1-(2-methylhydrazinyl)propan-2-yl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 134341698 |
| Molecular Formula | C7H20N4 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.17 |
| IUPAC Name | 1-N'-methyl-1-N'-[1-(2-methylhydrazinyl)propan-2-yl]ethane-1,1-diamine |
| SMILES | CNNCC(C)N(C)C(C)N |
| InChI | InChI=1S/C7H20N4/c1-6(5-10-9-3)11(4)7(2)8/h6-7,9-10H,5,8H2,1-4H3 |
| InChIKey | WTOYBBTXJRUPLO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|