C13H28N2O — CID 166075449
N-[4-(dimethylamino)-2-methylbutyl]cyclopropanecarboxamide;ethane (PubChem CID 166075449) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylbutyl]cyclopropanecarboxamide;ethane.
| Compound Name | N-[4-(dimethylamino)-2-methylbutyl]cyclopropanecarboxamide;ethane |
|---|---|
| PubChem CID | 166075449 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylbutyl]cyclopropanecarboxamide;ethane |
| SMILES | CC.CC(CCN(C)C)CNC(=O)C1CC1 |
| InChI | InChI=1S/C11H22N2O.C2H6/c1-9(6-7-13(2)3)8-12-11(14)10-4-5-10;1-2/h9-10H,4-8H2,1-3H3,(H,12,14);1-2H3 |
| InChIKey | KWHOZGFYRYBYDC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |