C10H24N2 — CID 20587648
5-N,5-N-diethylhexane-1,5-diamine (PubChem CID 20587648) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 5-N,5-N-diethylhexane-1,5-diamine.
| Compound Name | 5-N,5-N-diethylhexane-1,5-diamine |
|---|---|
| PubChem CID | 20587648 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 5-N,5-N-diethylhexane-1,5-diamine |
| SMILES | CCN(CC)C(C)CCCCN |
| InChI | InChI=1S/C10H24N2/c1-4-12(5-2)10(3)8-6-7-9-11/h10H,4-9,11H2,1-3H3 |
| InChIKey | NQGYYEFDBZYHEH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|