About ethane;5-methylheptan-1-amine
ethane;5-methylheptan-1-amine (PubChem CID 143088899) has the molecular formula C10H25N
and a molecular weight of 159.32 g/mol. Its IUPAC name is ethane;5-methylheptan-1-amine.
Molecular Properties
| Compound Name | ethane;5-methylheptan-1-amine |
| PubChem CID | 143088899 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | ethane;5-methylheptan-1-amine |
| SMILES | CC.CCC(C)CCCCN |
| InChI | InChI=1S/C8H19N.C2H6/c1-3-8(2)6-4-5-7-9;1-2/h8H,3-7,9H2,1-2H3;1-2H3 |
| InChIKey | WNLYIUBHQRGRBU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methylheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylheptan-1-amine?
The IUPAC name of ethane;5-methylheptan-1-amine (CID 143088899) is ethane;5-methylheptan-1-amine.
What is the SMILES notation for ethane;5-methylheptan-1-amine?
The canonical SMILES for ethane;5-methylheptan-1-amine is CC.CCC(C)CCCCN.
What is the InChIKey of ethane;5-methylheptan-1-amine?
The InChIKey is WNLYIUBHQRGRBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H6/c1-3-8(2)6-4-5-7-9;1-2/h8H,3-7,9H2,1-2H3;1-2H3.
What are the key properties of ethane;5-methylheptan-1-amine?
ethane;5-methylheptan-1-amine has a molecular weight of 159.32 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylheptan-1-amine is sourced from PubChem (CID 143088899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).