C9H21N — CID 89357634
(3S)-N-ethyl-N,3-dimethylpentan-1-amine (PubChem CID 89357634) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is (3S)-N-ethyl-N,3-dimethylpentan-1-amine.
| Compound Name | (3S)-N-ethyl-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 89357634 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | (3S)-N-ethyl-N,3-dimethylpentan-1-amine |
| SMILES | CC[C@H](C)CCN(C)CC |
| InChI | InChI=1S/C9H21N/c1-5-9(3)7-8-10(4)6-2/h9H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | VOZWXDWNTANOST-VIFPVBQESA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |