C12H27N — CID 123997066
N-ethyl-N,3,5-trimethylheptan-1-amine (PubChem CID 123997066) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is N-ethyl-N,3,5-trimethylheptan-1-amine.
| Compound Name | N-ethyl-N,3,5-trimethylheptan-1-amine |
|---|---|
| PubChem CID | 123997066 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | N-ethyl-N,3,5-trimethylheptan-1-amine |
| SMILES | CCC(C)CC(C)CCN(C)CC |
| InChI | InChI=1S/C12H27N/c1-6-11(3)10-12(4)8-9-13(5)7-2/h11-12H,6-10H2,1-5H3 |
| InChIKey | PTRHLTQSWKVJND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |