C15H31N — CID 163258522
N-(cycloheptylmethyl)-N,3-dimethylpentan-1-amine (PubChem CID 163258522) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-N,3-dimethylpentan-1-amine.
| Compound Name | N-(cycloheptylmethyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 163258522 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N-(cycloheptylmethyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CCN(C)CC1CCCCCC1 |
| InChI | InChI=1S/C15H31N/c1-4-14(2)11-12-16(3)13-15-9-7-5-6-8-10-15/h14-15H,4-13H2,1-3H3 |
| InChIKey | JFYXTMONCSRAKT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |