C10H26N2 — CID 153352387
ethane;1-N-ethyl-1-N,3-N-dimethylbutane-1,3-diamine (PubChem CID 153352387) has the molecular formula C10H26N2 and a molecular weight of 174.33 g/mol. Its IUPAC name is ethane;1-N-ethyl-1-N,3-N-dimethylbutane-1,3-diamine.
| Compound Name | ethane;1-N-ethyl-1-N,3-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 153352387 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | ethane;1-N-ethyl-1-N,3-N-dimethylbutane-1,3-diamine |
| SMILES | CC.CCN(C)CCC(C)NC |
| InChI | InChI=1S/C8H20N2.C2H6/c1-5-10(4)7-6-8(2)9-3;1-2/h8-9H,5-7H2,1-4H3;1-2H3 |
| InChIKey | IBPKOMAQQDXGAF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |