C10H23N3S — CID 111767355
1-butyl-2-methyl-3-(3-methylsulfanylpropyl)guanidine (PubChem CID 111767355) has the molecular formula C10H23N3S and a molecular weight of 217.38 g/mol. Its IUPAC name is 1-butyl-2-methyl-3-(3-methylsulfanylpropyl)guanidine.
| Compound Name | 1-butyl-2-methyl-3-(3-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111767355 |
| Molecular Formula | C10H23N3S |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-butyl-2-methyl-3-(3-methylsulfanylpropyl)guanidine |
| SMILES | CCCCN/C(=N\C)NCCCSC |
| InChI | InChI=1S/C10H23N3S/c1-4-5-7-12-10(11-2)13-8-6-9-14-3/h4-9H2,1-3H3,(H2,11,12,13) |
| InChIKey | KZQCPZYCXFECSI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|