C6H16N4S — CID 104882256
1-amino-2-methyl-3-(3-methylsulfanylpropyl)guanidine (PubChem CID 104882256) has the molecular formula C6H16N4S and a molecular weight of 176.29 g/mol. Its IUPAC name is 1-amino-2-methyl-3-(3-methylsulfanylpropyl)guanidine.
| Compound Name | 1-amino-2-methyl-3-(3-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 104882256 |
| Molecular Formula | C6H16N4S |
| Molecular Weight | 176.29 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-amino-2-methyl-3-(3-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(\NN)NCCCSC |
| InChI | InChI=1S/C6H16N4S/c1-8-6(10-7)9-4-3-5-11-2/h3-5,7H2,1-2H3,(H2,8,9,10) |
| InChIKey | UAOATZCKTFRKOY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|