C10H24IN3OS — CID 111626781
1-(2-methoxyethyl)-2-methyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111626781) has the molecular formula C10H24IN3OS and a molecular weight of 361.29 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-methyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-2-methyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111626781 |
| Molecular Formula | C10H24IN3OS |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-(2-methoxyethyl)-2-methyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCSC)NCCOC.I |
| InChI | InChI=1S/C10H23N3OS.HI/c1-11-10(13-7-8-14-2)12-6-4-5-9-15-3;/h4-9H2,1-3H3,(H2,11,12,13);1H |
| InChIKey | GHPFQJFFRKORMY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|