C9H18N2O3 — CID 71815737
ethyl (2R)-2-amino-5-(ethylamino)-5-oxopentanoate (PubChem CID 71815737) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is ethyl (2R)-2-amino-5-(ethylamino)-5-oxopentanoate.
| Compound Name | ethyl (2R)-2-amino-5-(ethylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 71815737 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | ethyl (2R)-2-amino-5-(ethylamino)-5-oxopentanoate |
| SMILES | CCNC(=O)CC[C@@H](N)C(=O)OCC |
| InChI | InChI=1S/C9H18N2O3/c1-3-11-8(12)6-5-7(10)9(13)14-4-2/h7H,3-6,10H2,1-2H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | JYYILPKRJDOTRS-SSDOTTSWSA-N |
| XLogP | -0.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |