C6H4F9NO — CID 134921957
(Z)-3,3,3-trifluoro-2-methoxy-N,N-bis(trifluoromethyl)prop-1-en-1-amine (PubChem CID 134921957) has the molecular formula C6H4F9NO and a molecular weight of 277.09 g/mol. Its IUPAC name is (Z)-3,3,3-trifluoro-2-methoxy-N,N-bis(trifluoromethyl)prop-1-en-1-amine.
| Compound Name | (Z)-3,3,3-trifluoro-2-methoxy-N,N-bis(trifluoromethyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 134921957 |
| Molecular Formula | C6H4F9NO |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | (Z)-3,3,3-trifluoro-2-methoxy-N,N-bis(trifluoromethyl)prop-1-en-1-amine |
| SMILES | CO/C(=C\N(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F9NO/c1-17-3(4(7,8)9)2-16(5(10,11)12)6(13,14)15/h2H,1H3/b3-2- |
| InChIKey | MLXWCIFYYMHSIY-IHWYPQMZSA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|