C10H6F12O2 — CID 177437999
(2Z,4Z)-1,1,1,6,6,6-hexafluoro-2,5-dimethoxy-3,4-bis(trifluoromethyl)hexa-2,4-diene (PubChem CID 177437999) has the molecular formula C10H6F12O2 and a molecular weight of 386.13 g/mol. Its IUPAC name is (2Z,4Z)-1,1,1,6,6,6-hexafluoro-2,5-dimethoxy-3,4-bis(trifluoromethyl)hexa-2,4-diene.
| Compound Name | (2Z,4Z)-1,1,1,6,6,6-hexafluoro-2,5-dimethoxy-3,4-bis(trifluoromethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 177437999 |
| Molecular Formula | C10H6F12O2 |
| Molecular Weight | 386.13 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (2Z,4Z)-1,1,1,6,6,6-hexafluoro-2,5-dimethoxy-3,4-bis(trifluoromethyl)hexa-2,4-diene |
| SMILES | CO/C(=C(C(=C(/OC)C(F)(F)F)/C(F)(F)F)\C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F12O2/c1-23-5(9(17,18)19)3(7(11,12)13)4(8(14,15)16)6(24-2)10(20,21)22/h1-2H3/b5-3-,6-4- |
| InChIKey | MUIOQOJBRNHZQX-GLIMQPGKSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.13 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|