C10H3F17O — CID 15124830
1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-4-(trifluoromethyl)pent-2-ene (PubChem CID 15124830) has the molecular formula C10H3F17O and a molecular weight of 462.10 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 15124830 |
| Molecular Formula | C10H3F17O |
| Molecular Weight | 462.10 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxy-4-(trifluoromethyl)pent-2-ene |
| SMILES | COC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3F17O/c1-28-3(6(13,14)15)2(4(11,7(16,17)18)8(19,20)21)5(12,9(22,23)24)10(25,26)27/h1H3 |
| InChIKey | ICDOJJYBTLBLAX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.10 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|