C6HF13LiNO4S — CID 173339181
lithium;fluoro 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate;hydride (PubChem CID 173339181) has the molecular formula C6HF13LiNO4S and a molecular weight of 437.06 g/mol. Its IUPAC name is lithium;fluoro 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate;hydride.
| Compound Name | lithium;fluoro 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate;hydride |
|---|---|
| PubChem CID | 173339181 |
| Molecular Formula | C6HF13LiNO4S |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 436.96 |
| IUPAC Name | lithium;fluoro 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate;hydride |
| SMILES | O=S(=O)(OF)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F.[H-].[Li+] |
| InChI | InChI=1S/C6F13NO4S.Li.H/c7-1(8)4(13,14)23-5(15,16)2(9,10)20(1)3(11,12)6(17,18)25(21,22)24-19;;/q;+1;-1 |
| InChIKey | HWDHIORNEWXKEN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|