C8H8F4O — CID 173272425
2-(1,1-difluoroprop-2-enyl)-3,3-difluoropent-4-enal (PubChem CID 173272425) has the molecular formula C8H8F4O and a molecular weight of 196.14 g/mol. Its IUPAC name is 2-(1,1-difluoroprop-2-enyl)-3,3-difluoropent-4-enal.
| Compound Name | 2-(1,1-difluoroprop-2-enyl)-3,3-difluoropent-4-enal |
|---|---|
| PubChem CID | 173272425 |
| Molecular Formula | C8H8F4O |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-(1,1-difluoroprop-2-enyl)-3,3-difluoropent-4-enal |
| SMILES | C=CC(F)(F)C(C=O)C(F)(F)C=C |
| InChI | InChI=1S/C8H8F4O/c1-3-7(9,10)6(5-13)8(11,12)4-2/h3-6H,1-2H2 |
| InChIKey | TULPGIKHNYASJZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|