C8HF15O2 — CID 102507978
2,3,3,5,5,5-hexafluoro-2,4,4-tris(trifluoromethyl)pentanoic acid (PubChem CID 102507978) has the molecular formula C8HF15O2 and a molecular weight of 414.06 g/mol. Its IUPAC name is 2,3,3,5,5,5-hexafluoro-2,4,4-tris(trifluoromethyl)pentanoic acid.
| Compound Name | 2,3,3,5,5,5-hexafluoro-2,4,4-tris(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 102507978 |
| Molecular Formula | C8HF15O2 |
| Molecular Weight | 414.06 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 2,3,3,5,5,5-hexafluoro-2,4,4-tris(trifluoromethyl)pentanoic acid |
| SMILES | O=C(O)C(F)(C(F)(F)F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O2/c9-2(1(24)25,5(12,13)14)4(10,11)3(6(15,16)17,7(18,19)20)8(21,22)23/h(H,24,25) |
| InChIKey | XREGJQQQMQWWNN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.06 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |