C18HF35O2 — CID 139774778
2,3,3,4,4,5,6,6,8,8,8-undecafluoro-2-[1,1,1,2,3,3,5,5,5-nonafluoro-4,4-bis(trifluoromethyl)pentan-2-yl]-5,7,7-tris(trifluoromethyl)octanoic acid (PubChem CID 139774778) has the molecular formula C18HF35O2 and a molecular weight of 914.13 g/mol. Its IUPAC name is 2,3,3,4,4,5,6,6,8,8,8-undecafluoro-2-[1,1,1,2,3,3,5,5,5-nonafluoro-4,4-bis(trifluoromethyl)pentan-2-yl]-5,7,7-tris(trifluoromethyl)octanoic acid.
| Compound Name | 2,3,3,4,4,5,6,6,8,8,8-undecafluoro-2-[1,1,1,2,3,3,5,5,5-nonafluoro-4,4-bis(trifluoromethyl)pentan-2-yl]-5,7,7-tris(trifluoromethyl)octanoic acid |
|---|---|
| PubChem CID | 139774778 |
| Molecular Formula | C18HF35O2 |
| Molecular Weight | 914.13 g/mol |
| Exact Mass | 913.94 |
| IUPAC Name | 2,3,3,4,4,5,6,6,8,8,8-undecafluoro-2-[1,1,1,2,3,3,5,5,5-nonafluoro-4,4-bis(trifluoromethyl)pentan-2-yl]-5,7,7-tris(trifluoromethyl)octanoic acid |
| SMILES | O=C(O)C(F)(C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18HF35O2/c19-2(1(54)55,5(20,17(48,49)50)8(24,25)3(11(30,31)32,12(33,34)35)13(36,37)38)7(22,23)10(28,29)6(21,18(51,52)53)9(26,27)4(14(39,40)41,15(42,43)44)16(45,46)47/h(H,54,55) |
| InChIKey | PWQDQPIOBSOATL-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.13 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|