C14H7F18N2O4- — CID 140799716
3-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]propanoate (PubChem CID 140799716) has the molecular formula C14H7F18N2O4- and a molecular weight of 609.18 g/mol. Its IUPAC name is 3-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]propanoate.
| Compound Name | 3-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 140799716 |
| Molecular Formula | C14H7F18N2O4- |
| Molecular Weight | 609.18 g/mol |
| Exact Mass | 609.01 |
| IUPAC Name | 3-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]propanoate |
| SMILES | CN(CCC(=O)[O-])C(=O)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(C(F)(F)F)OC(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C14H8F18N2O4/c1-33(3-2-4(35)36)5(37)6(15,9(18,19)20)12(27,28)34-13(29,30)7(16,10(21,22)23)38-8(17,11(24,25)26)14(34,31)32/h2-3H2,1H3,(H,35,36)/p-1 |
| InChIKey | DWENZPBRPCNONE-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|