About bis(3-(dipropylamino)propanoate);nickel(2+)
bis(3-(dipropylamino)propanoate);nickel(2+) (PubChem CID 88802202) has the molecular formula C18H36N2NiO4
and a molecular weight of 403.19 g/mol. Its IUPAC name is bis(3-(dipropylamino)propanoate);nickel(2+).
Molecular Properties
| Compound Name | bis(3-(dipropylamino)propanoate);nickel(2+) |
| PubChem CID | 88802202 |
| Molecular Formula | C18H36N2NiO4 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | bis(3-(dipropylamino)propanoate);nickel(2+) |
| SMILES | CCCN(CCC)CCC(=O)[O-].CCCN(CCC)CCC(=O)[O-].[Ni+2] |
| InChI | InChI=1S/2C9H19NO2.Ni/c2*1-3-6-10(7-4-2)8-5-9(11)12;/h2*3-8H2,1-2H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | VCAIDVKGJHYOAU-UHFFFAOYSA-L |
| XLogP | 0.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(3-(dipropylamino)propanoate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-(dipropylamino)propanoate);nickel(2+)?
The IUPAC name of bis(3-(dipropylamino)propanoate);nickel(2+) (CID 88802202) is bis(3-(dipropylamino)propanoate);nickel(2+).
What is the SMILES notation for bis(3-(dipropylamino)propanoate);nickel(2+)?
The canonical SMILES for bis(3-(dipropylamino)propanoate);nickel(2+) is CCCN(CCC)CCC(=O)[O-].CCCN(CCC)CCC(=O)[O-].[Ni+2].
What is the InChIKey of bis(3-(dipropylamino)propanoate);nickel(2+)?
The InChIKey is VCAIDVKGJHYOAU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H19NO2.Ni/c2*1-3-6-10(7-4-2)8-5-9(11)12;/h2*3-8H2,1-2H3,(H,11,12);/q;;+2/p-2.
What are the key properties of bis(3-(dipropylamino)propanoate);nickel(2+)?
bis(3-(dipropylamino)propanoate);nickel(2+) has a molecular weight of 403.19 g/mol, XLogP of 0.49, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-(dipropylamino)propanoate);nickel(2+) is sourced from PubChem (CID 88802202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).