C14H21N2Na4O8- — CID 154597232
tetrasodium;3-[2-[bis(2-carboxylatoethyl)amino]ethyl-(3-oxopropyl)amino]propanoate;hydroxide (PubChem CID 154597232) has the molecular formula C14H21N2Na4O8- and a molecular weight of 437.29 g/mol. Its IUPAC name is tetrasodium;3-[2-[bis(2-carboxylatoethyl)amino]ethyl-(3-oxopropyl)amino]propanoate;hydroxide.
| Compound Name | tetrasodium;3-[2-[bis(2-carboxylatoethyl)amino]ethyl-(3-oxopropyl)amino]propanoate;hydroxide |
|---|---|
| PubChem CID | 154597232 |
| Molecular Formula | C14H21N2Na4O8- |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | tetrasodium;3-[2-[bis(2-carboxylatoethyl)amino]ethyl-(3-oxopropyl)amino]propanoate;hydroxide |
| SMILES | O=[C-]CCN(CCC(=O)[O-])CCN(CCC(=O)[O-])CCC(=O)[O-].[Na+].[Na+].[Na+].[Na+].[OH-] |
| InChI | InChI=1S/C14H23N2O7.4Na.H2O/c17-11-1-5-15(6-2-12(18)19)9-10-16(7-3-13(20)21)8-4-14(22)23;;;;;/h1-10H2,(H,18,19)(H,20,21)(H,22,23);;;;;1H2/q-1;4*+1;/p-4 |
| InChIKey | NFGMFSYKCGZTOX-UHFFFAOYSA-J |
| XLogP | -16.65 |
| TPSA | 173.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | -16.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|