C8H3F8NO2 — CID 23002765
1,2,2,3,3,4,4,4-octafluorobutyl 2-cyanoprop-2-enoate (PubChem CID 23002765) has the molecular formula C8H3F8NO2 and a molecular weight of 297.10 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,4-octafluorobutyl 2-cyanoprop-2-enoate.
| Compound Name | 1,2,2,3,3,4,4,4-octafluorobutyl 2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 23002765 |
| Molecular Formula | C8H3F8NO2 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1,2,2,3,3,4,4,4-octafluorobutyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OC(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F8NO2/c1-3(2-17)4(18)19-5(9)6(10,11)7(12,13)8(14,15)16/h5H,1H2 |
| InChIKey | MGEFGWUUYSIPRV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|