About 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate
1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate (PubChem CID 170426406) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate |
| PubChem CID | 170426406 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OC(C)OC(C)OC |
| InChI | InChI=1S/C9H13NO4/c1-6(5-10)9(11)14-8(3)13-7(2)12-4/h7-8H,1H2,2-4H3 |
| InChIKey | HJFWQHVILFWNKJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate?
The IUPAC name of 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate (CID 170426406) is 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate.
What is the SMILES notation for 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate?
The canonical SMILES for 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OC(C)OC(C)OC.
What is the InChIKey of 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate?
The InChIKey is HJFWQHVILFWNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c1-6(5-10)9(11)14-8(3)13-7(2)12-4/h7-8H,1H2,2-4H3.
What are the key properties of 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate?
1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate has a molecular weight of 199.21 g/mol, XLogP of 0.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxyethoxy)ethyl 2-cyanoprop-2-enoate is sourced from PubChem (CID 170426406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).