About 1-propoxypropyl 2-cyanoprop-2-enoate
1-propoxypropyl 2-cyanoprop-2-enoate (PubChem CID 87744314) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-propoxypropyl 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | 1-propoxypropyl 2-cyanoprop-2-enoate |
| PubChem CID | 87744314 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-propoxypropyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OC(CC)OCCC |
| InChI | InChI=1S/C10H15NO3/c1-4-6-13-9(5-2)14-10(12)8(3)7-11/h9H,3-6H2,1-2H3 |
| InChIKey | MXMDMKQPIDJLNN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxypropyl 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxypropyl 2-cyanoprop-2-enoate?
The IUPAC name of 1-propoxypropyl 2-cyanoprop-2-enoate (CID 87744314) is 1-propoxypropyl 2-cyanoprop-2-enoate.
What is the SMILES notation for 1-propoxypropyl 2-cyanoprop-2-enoate?
The canonical SMILES for 1-propoxypropyl 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OC(CC)OCCC.
What is the InChIKey of 1-propoxypropyl 2-cyanoprop-2-enoate?
The InChIKey is MXMDMKQPIDJLNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-4-6-13-9(5-2)14-10(12)8(3)7-11/h9H,3-6H2,1-2H3.
What are the key properties of 1-propoxypropyl 2-cyanoprop-2-enoate?
1-propoxypropyl 2-cyanoprop-2-enoate has a molecular weight of 197.23 g/mol, XLogP of 1.77, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxypropyl 2-cyanoprop-2-enoate is sourced from PubChem (CID 87744314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).