About 1-propoxypropyl 2-cyano-2-methoxyacetate
1-propoxypropyl 2-cyano-2-methoxyacetate (PubChem CID 20514541) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-propoxypropyl 2-cyano-2-methoxyacetate.
Molecular Properties
| Compound Name | 1-propoxypropyl 2-cyano-2-methoxyacetate |
| PubChem CID | 20514541 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-propoxypropyl 2-cyano-2-methoxyacetate |
| SMILES | CCCOC(CC)OC(=O)C(C#N)OC |
| InChI | InChI=1S/C10H17NO4/c1-4-6-14-9(5-2)15-10(12)8(7-11)13-3/h8-9H,4-6H2,1-3H3 |
| InChIKey | JWSKFFYWAOTKKE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxypropyl 2-cyano-2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxypropyl 2-cyano-2-methoxyacetate?
The IUPAC name of 1-propoxypropyl 2-cyano-2-methoxyacetate (CID 20514541) is 1-propoxypropyl 2-cyano-2-methoxyacetate.
What is the SMILES notation for 1-propoxypropyl 2-cyano-2-methoxyacetate?
The canonical SMILES for 1-propoxypropyl 2-cyano-2-methoxyacetate is CCCOC(CC)OC(=O)C(C#N)OC.
What is the InChIKey of 1-propoxypropyl 2-cyano-2-methoxyacetate?
The InChIKey is JWSKFFYWAOTKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-4-6-14-9(5-2)15-10(12)8(7-11)13-3/h8-9H,4-6H2,1-3H3.
What are the key properties of 1-propoxypropyl 2-cyano-2-methoxyacetate?
1-propoxypropyl 2-cyano-2-methoxyacetate has a molecular weight of 215.25 g/mol, XLogP of 1.23, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxypropyl 2-cyano-2-methoxyacetate is sourced from PubChem (CID 20514541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).