C13H18NNaO9S — CID 172548249
sodium [(2R,3R,4S,5R)-6-(benzylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate (PubChem CID 172548249) has the molecular formula C13H18NNaO9S and a molecular weight of 387.34 g/mol. Its IUPAC name is sodium [(2R,3R,4S,5R)-6-(benzylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate.
| Compound Name | sodium [(2R,3R,4S,5R)-6-(benzylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate |
|---|---|
| PubChem CID | 172548249 |
| Molecular Formula | C13H18NNaO9S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | sodium [(2R,3R,4S,5R)-6-(benzylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate |
| SMILES | O=C(NCc1ccccc1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H19NO9S.Na/c15-9(7-23-24(20,21)22)10(16)11(17)12(18)13(19)14-6-8-4-2-1-3-5-8;/h1-5,9-12,15-18H,6-7H2,(H,14,19)(H,20,21,22);/q;+1/p-1/t9-,10-,11+,12-;/m1./s1 |
| InChIKey | DXEFWDCXZNVVBT-QTWKXRMISA-M |
| XLogP | -5.77 |
| TPSA | 176.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|