C10H20NNaO11S — CID 172548185
sodium [(2R,3R,4S,5R,6R)-2,3,4,5,6-pentahydroxy-7-(3-hydroxypropylamino)-7-oxoheptyl] sulfate (PubChem CID 172548185) has the molecular formula C10H20NNaO11S and a molecular weight of 385.32 g/mol. Its IUPAC name is sodium [(2R,3R,4S,5R,6R)-2,3,4,5,6-pentahydroxy-7-(3-hydroxypropylamino)-7-oxoheptyl] sulfate.
| Compound Name | sodium [(2R,3R,4S,5R,6R)-2,3,4,5,6-pentahydroxy-7-(3-hydroxypropylamino)-7-oxoheptyl] sulfate |
|---|---|
| PubChem CID | 172548185 |
| Molecular Formula | C10H20NNaO11S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | sodium [(2R,3R,4S,5R,6R)-2,3,4,5,6-pentahydroxy-7-(3-hydroxypropylamino)-7-oxoheptyl] sulfate |
| SMILES | O=C(NCCCO)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H21NO11S.Na/c12-3-1-2-11-10(18)9(17)8(16)7(15)6(14)5(13)4-22-23(19,20)21;/h5-9,12-17H,1-4H2,(H,11,18)(H,19,20,21);/q;+1/p-1/t5-,6-,7+,8-,9-;/m1./s1 |
| InChIKey | NQOFOUJBQPGUTA-NVRBWUGSSA-M |
| XLogP | -8.23 |
| TPSA | 216.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | -8.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|