C14H28NNaO9S — CID 172548220
sodium [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-(octylamino)-6-oxohexyl] sulfate (PubChem CID 172548220) has the molecular formula C14H28NNaO9S and a molecular weight of 409.43 g/mol. Its IUPAC name is sodium [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-(octylamino)-6-oxohexyl] sulfate.
| Compound Name | sodium [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-(octylamino)-6-oxohexyl] sulfate |
|---|---|
| PubChem CID | 172548220 |
| Molecular Formula | C14H28NNaO9S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | sodium [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-(octylamino)-6-oxohexyl] sulfate |
| SMILES | CCCCCCCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H29NO9S.Na/c1-2-3-4-5-6-7-8-15-14(20)13(19)12(18)11(17)10(16)9-24-25(21,22)23;/h10-13,16-19H,2-9H2,1H3,(H,15,20)(H,21,22,23);/q;+1/p-1/t10-,11-,12+,13-;/m1./s1 |
| InChIKey | FWNXAIGSWIJKQD-NKOBOTCDSA-M |
| XLogP | -4.61 |
| TPSA | 176.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|