C18H37N2NaO9S — CID 172548191
sodium [(2R,3R,4S,5R)-6-[3-[butyl(pentyl)amino]propylamino]-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate (PubChem CID 172548191) has the molecular formula C18H37N2NaO9S and a molecular weight of 480.56 g/mol. Its IUPAC name is sodium [(2R,3R,4S,5R)-6-[3-[butyl(pentyl)amino]propylamino]-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate.
| Compound Name | sodium [(2R,3R,4S,5R)-6-[3-[butyl(pentyl)amino]propylamino]-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate |
|---|---|
| PubChem CID | 172548191 |
| Molecular Formula | C18H37N2NaO9S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | sodium [(2R,3R,4S,5R)-6-[3-[butyl(pentyl)amino]propylamino]-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate |
| SMILES | CCCCCN(CCCC)CCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H38N2O9S.Na/c1-3-5-7-11-20(10-6-4-2)12-8-9-19-18(25)17(24)16(23)15(22)14(21)13-29-30(26,27)28;/h14-17,21-24H,3-13H2,1-2H3,(H,19,25)(H,26,27,28);/q;+1/p-1/t14-,15-,16+,17-;/m1./s1 |
| InChIKey | TVGNIUKNZMTCNI-AVWYVPSCSA-M |
| XLogP | -4.29 |
| TPSA | 179.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|