C6H11O9S- — CID 21120827
[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate (PubChem CID 21120827) has the molecular formula C6H11O9S- and a molecular weight of 259.21 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate.
| Compound Name | [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate |
|---|---|
| PubChem CID | 21120827 |
| Molecular Formula | C6H11O9S- |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] sulfate |
| SMILES | O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H12O9S/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,8-11H,2H2,(H,12,13,14)/p-1/t3-,4-,5-,6-/m1/s1 |
| InChIKey | BCUVLMCXSDWQQC-KVTDHHQDSA-M |
| XLogP | -3.89 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|