C6H12O14S2Ti — CID 174821298
2,3,4,5,6-pentahydroxyhexanal;titanium(4+);disulfate (PubChem CID 174821298) has the molecular formula C6H12O14S2Ti and a molecular weight of 420.15 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;titanium(4+);disulfate.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;titanium(4+);disulfate |
|---|---|
| PubChem CID | 174821298 |
| Molecular Formula | C6H12O14S2Ti |
| Molecular Weight | 420.15 g/mol |
| Exact Mass | 419.91 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;titanium(4+);disulfate |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Ti+4] |
| InChI | InChI=1S/C6H12O6.2H2O4S.Ti/c7-1-3(9)5(11)6(12)4(10)2-8;2*1-5(2,3)4;/h1,3-6,8-12H,2H2;2*(H2,1,2,3,4);/q;;;+4/p-4 |
| InChIKey | XUJBZLAPPJKXQY-UHFFFAOYSA-J |
| XLogP | -6.06 |
| TPSA | 278.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.15 |
| LogP ≤ 5 | -6.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|