C22H31NO2 — CID 101401413
(2R,4R,5S)-5-(dibenzylamino)-6-methylheptane-2,4-diol (PubChem CID 101401413) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2R,4R,5S)-5-(dibenzylamino)-6-methylheptane-2,4-diol.
| Compound Name | (2R,4R,5S)-5-(dibenzylamino)-6-methylheptane-2,4-diol |
|---|---|
| PubChem CID | 101401413 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (2R,4R,5S)-5-(dibenzylamino)-6-methylheptane-2,4-diol |
| SMILES | CC(C)[C@@H]([C@H](O)C[C@@H](C)O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO2/c1-17(2)22(21(25)14-18(3)24)23(15-19-10-6-4-7-11-19)16-20-12-8-5-9-13-20/h4-13,17-18,21-22,24-25H,14-16H2,1-3H3/t18-,21-,22+/m1/s1 |
| InChIKey | WHNPBVJZYSITFP-QIJUGHKUSA-N |
| XLogP | 3.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |