C23H32N2O — CID 59051627
(2S,3S)-1-(cyclopropylamino)-3-(dibenzylamino)-4-methylpentan-2-ol (PubChem CID 59051627) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is (2S,3S)-1-(cyclopropylamino)-3-(dibenzylamino)-4-methylpentan-2-ol.
| Compound Name | (2S,3S)-1-(cyclopropylamino)-3-(dibenzylamino)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 59051627 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | (2S,3S)-1-(cyclopropylamino)-3-(dibenzylamino)-4-methylpentan-2-ol |
| SMILES | CC(C)[C@@H]([C@@H](O)CNC1CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O/c1-18(2)23(22(26)15-24-21-13-14-21)25(16-19-9-5-3-6-10-19)17-20-11-7-4-8-12-20/h3-12,18,21-24,26H,13-17H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | UARABECIUUKJBO-GOTSBHOMSA-N |
| XLogP | 3.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |