C27H34N2 — CID 10992685
(2S,3S)-3-N,3-N,2-tribenzyl-4-methylpentane-1,3-diamine (PubChem CID 10992685) has the molecular formula C27H34N2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (2S,3S)-3-N,3-N,2-tribenzyl-4-methylpentane-1,3-diamine.
| Compound Name | (2S,3S)-3-N,3-N,2-tribenzyl-4-methylpentane-1,3-diamine |
|---|---|
| PubChem CID | 10992685 |
| Molecular Formula | C27H34N2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2S,3S)-3-N,3-N,2-tribenzyl-4-methylpentane-1,3-diamine |
| SMILES | CC(C)[C@@H]([C@H](CN)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H34N2/c1-22(2)27(26(19-28)18-23-12-6-3-7-13-23)29(20-24-14-8-4-9-15-24)21-25-16-10-5-11-17-25/h3-17,22,26-27H,18-21,28H2,1-2H3/t26-,27-/m0/s1 |
| InChIKey | IEPALVHSIDRJIN-SVBPBHIXSA-N |
| XLogP | 5.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |