C26H37NO2 — CID 174971253
tert-butyl 3-[benzyl(2-phenylethyl)amino]heptanoate (PubChem CID 174971253) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is tert-butyl 3-[benzyl(2-phenylethyl)amino]heptanoate.
| Compound Name | tert-butyl 3-[benzyl(2-phenylethyl)amino]heptanoate |
|---|---|
| PubChem CID | 174971253 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | tert-butyl 3-[benzyl(2-phenylethyl)amino]heptanoate |
| SMILES | CCCCC(CC(=O)OC(C)(C)C)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H37NO2/c1-5-6-17-24(20-25(28)29-26(2,3)4)27(21-23-15-11-8-12-16-23)19-18-22-13-9-7-10-14-22/h7-16,24H,5-6,17-21H2,1-4H3 |
| InChIKey | KHGFUMRHWJESIH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |