C23H29NO3 — CID 11595782
[(2S,3S)-3-(dibenzylamino)-2-hydroxybutyl] (E)-pent-2-enoate (PubChem CID 11595782) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is [(2S,3S)-3-(dibenzylamino)-2-hydroxybutyl] (E)-pent-2-enoate.
| Compound Name | [(2S,3S)-3-(dibenzylamino)-2-hydroxybutyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 11595782 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(2S,3S)-3-(dibenzylamino)-2-hydroxybutyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OC[C@@H](O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-3-4-15-23(26)27-18-22(25)19(2)24(16-20-11-7-5-8-12-20)17-21-13-9-6-10-14-21/h4-15,19,22,25H,3,16-18H2,1-2H3/b15-4+/t19-,22+/m0/s1 |
| InChIKey | SNWDNTBUZZDBJP-HRUPEFEASA-N |
| XLogP | 3.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|