C24H31NOSi — CID 11337892
(3R,4R)-4-(dibenzylamino)-2-methyl-6-trimethylsilylhex-1-en-5-yn-3-ol (PubChem CID 11337892) has the molecular formula C24H31NOSi and a molecular weight of 377.60 g/mol. Its IUPAC name is (3R,4R)-4-(dibenzylamino)-2-methyl-6-trimethylsilylhex-1-en-5-yn-3-ol.
| Compound Name | (3R,4R)-4-(dibenzylamino)-2-methyl-6-trimethylsilylhex-1-en-5-yn-3-ol |
|---|---|
| PubChem CID | 11337892 |
| Molecular Formula | C24H31NOSi |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (3R,4R)-4-(dibenzylamino)-2-methyl-6-trimethylsilylhex-1-en-5-yn-3-ol |
| SMILES | C=C(C)[C@@H](O)[C@@H](C#C[Si](C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NOSi/c1-20(2)24(26)23(16-17-27(3,4)5)25(18-21-12-8-6-9-13-21)19-22-14-10-7-11-15-22/h6-15,23-24,26H,1,18-19H2,2-5H3/t23-,24-/m1/s1 |
| InChIKey | BALCJDRJXPRKFV-DNQXCXABSA-N |
| XLogP | 4.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|