C26H37NOSi — CID 102463026
(2S,3R)-N,N-dibenzyl-4-methyl-2-prop-2-enyl-3-trimethylsilyloxypent-4-en-1-amine (PubChem CID 102463026) has the molecular formula C26H37NOSi and a molecular weight of 407.67 g/mol. Its IUPAC name is (2S,3R)-N,N-dibenzyl-4-methyl-2-prop-2-enyl-3-trimethylsilyloxypent-4-en-1-amine.
| Compound Name | (2S,3R)-N,N-dibenzyl-4-methyl-2-prop-2-enyl-3-trimethylsilyloxypent-4-en-1-amine |
|---|---|
| PubChem CID | 102463026 |
| Molecular Formula | C26H37NOSi |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (2S,3R)-N,N-dibenzyl-4-methyl-2-prop-2-enyl-3-trimethylsilyloxypent-4-en-1-amine |
| SMILES | C=CC[C@@H](CN(Cc1ccccc1)Cc1ccccc1)[C@@H](O[Si](C)(C)C)C(=C)C |
| InChI | InChI=1S/C26H37NOSi/c1-7-14-25(26(22(2)3)28-29(4,5)6)21-27(19-23-15-10-8-11-16-23)20-24-17-12-9-13-18-24/h7-13,15-18,25-26H,1-2,14,19-21H2,3-6H3/t25-,26-/m0/s1 |
| InChIKey | PGGKYPDGIUQVTF-UIOOFZCWSA-N |
| XLogP | 6.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|