C19H24N2 — CID 130698505
1-N,1-N-dibenzylpent-4-ene-1,2-diamine (PubChem CID 130698505) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-N,1-N-dibenzylpent-4-ene-1,2-diamine.
| Compound Name | 1-N,1-N-dibenzylpent-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 130698505 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-N,1-N-dibenzylpent-4-ene-1,2-diamine |
| SMILES | C=CCC(N)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2/c1-2-9-19(20)16-21(14-17-10-5-3-6-11-17)15-18-12-7-4-8-13-18/h2-8,10-13,19H,1,9,14-16,20H2 |
| InChIKey | DFDJRCYFCRAHPQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|