C23H31NSi — CID 102502700
(3R)-N,N-dibenzyl-4-methyl-1-trimethylsilylpent-1-yn-3-amine (PubChem CID 102502700) has the molecular formula C23H31NSi and a molecular weight of 349.59 g/mol. Its IUPAC name is (3R)-N,N-dibenzyl-4-methyl-1-trimethylsilylpent-1-yn-3-amine.
| Compound Name | (3R)-N,N-dibenzyl-4-methyl-1-trimethylsilylpent-1-yn-3-amine |
|---|---|
| PubChem CID | 102502700 |
| Molecular Formula | C23H31NSi |
| Molecular Weight | 349.59 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (3R)-N,N-dibenzyl-4-methyl-1-trimethylsilylpent-1-yn-3-amine |
| SMILES | CC(C)[C@H](C#C[Si](C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NSi/c1-20(2)23(16-17-25(3,4)5)24(18-21-12-8-6-9-13-21)19-22-14-10-7-11-15-22/h6-15,20,23H,18-19H2,1-5H3/t23-/m0/s1 |
| InChIKey | FGBIFJKRUIKLSP-QHCPKHFHSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|