C24H33NSi — CID 11473957
(3S)-N,N-dibenzyl-1-trimethylsilylhept-1-yn-3-amine (PubChem CID 11473957) has the molecular formula C24H33NSi and a molecular weight of 363.62 g/mol. Its IUPAC name is (3S)-N,N-dibenzyl-1-trimethylsilylhept-1-yn-3-amine.
| Compound Name | (3S)-N,N-dibenzyl-1-trimethylsilylhept-1-yn-3-amine |
|---|---|
| PubChem CID | 11473957 |
| Molecular Formula | C24H33NSi |
| Molecular Weight | 363.62 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (3S)-N,N-dibenzyl-1-trimethylsilylhept-1-yn-3-amine |
| SMILES | CCCC[C@@H](C#C[Si](C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H33NSi/c1-5-6-17-24(18-19-26(2,3)4)25(20-22-13-9-7-10-14-22)21-23-15-11-8-12-16-23/h7-16,24H,5-6,17,20-21H2,1-4H3/t24-/m0/s1 |
| InChIKey | XUOURBQALYFZMI-DEOSSOPVSA-N |
| XLogP | 6.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|