C16H25NSi — CID 86258799
N-(4,4-dimethyl-1-trimethylsilylpent-1-yn-3-yl)aniline (PubChem CID 86258799) has the molecular formula C16H25NSi and a molecular weight of 259.47 g/mol. Its IUPAC name is N-(4,4-dimethyl-1-trimethylsilylpent-1-yn-3-yl)aniline.
| Compound Name | N-(4,4-dimethyl-1-trimethylsilylpent-1-yn-3-yl)aniline |
|---|---|
| PubChem CID | 86258799 |
| Molecular Formula | C16H25NSi |
| Molecular Weight | 259.47 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-(4,4-dimethyl-1-trimethylsilylpent-1-yn-3-yl)aniline |
| SMILES | CC(C)(C)C(C#C[Si](C)(C)C)Nc1ccccc1 |
| InChI | InChI=1S/C16H25NSi/c1-16(2,3)15(12-13-18(4,5)6)17-14-10-8-7-9-11-14/h7-11,15,17H,1-6H3 |
| InChIKey | CAHUCZZDJZBXRX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|