C12H15BrN2 — CID 61326619
2-(4-bromoanilino)-3,3-dimethylbutanenitrile (PubChem CID 61326619) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 2-(4-bromoanilino)-3,3-dimethylbutanenitrile.
| Compound Name | 2-(4-bromoanilino)-3,3-dimethylbutanenitrile |
|---|---|
| PubChem CID | 61326619 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-(4-bromoanilino)-3,3-dimethylbutanenitrile |
| SMILES | CC(C)(C)C(C#N)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrN2/c1-12(2,3)11(8-14)15-10-6-4-9(13)5-7-10/h4-7,11,15H,1-3H3 |
| InChIKey | IMWNLGPTJYAYNX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |