C10H8BrF3N2 — CID 103366960
2-[(4-bromoanilino)methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103366960) has the molecular formula C10H8BrF3N2 and a molecular weight of 293.09 g/mol. Its IUPAC name is 2-[(4-bromoanilino)methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[(4-bromoanilino)methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103366960 |
| Molecular Formula | C10H8BrF3N2 |
| Molecular Weight | 293.09 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-[(4-bromoanilino)methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | N#CC(CNc1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H8BrF3N2/c11-8-1-3-9(4-2-8)16-6-7(5-15)10(12,13)14/h1-4,7,16H,6H2 |
| InChIKey | RBDURTJUHMIMJP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.09 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |