C14H18F3N3 — CID 103367269
2-[[4-(diethylamino)anilino]methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103367269) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[[4-(diethylamino)anilino]methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[[4-(diethylamino)anilino]methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103367269 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[[4-(diethylamino)anilino]methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | CCN(CC)c1ccc(NCC(C#N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3N3/c1-3-20(4-2)13-7-5-12(6-8-13)19-10-11(9-18)14(15,16)17/h5-8,11,19H,3-4,10H2,1-2H3 |
| InChIKey | CNNIUEGUHIOLKG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|