C13H15F3N2 — CID 103367853
2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103367853) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103367853 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | CCN(CC(C#N)C(F)(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15F3N2/c1-3-18(9-11(8-17)13(14,15)16)12-6-4-10(2)5-7-12/h4-7,11H,3,9H2,1-2H3 |
| InChIKey | FGPKBCFJTFTJJU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|