C17H30N2 — CID 62437274
N-tert-butyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine (PubChem CID 62437274) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-tert-butyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine.
| Compound Name | N-tert-butyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62437274 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-tert-butyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine |
| SMILES | CCN(CC(C)CNC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H30N2/c1-7-19(16-10-8-14(2)9-11-16)13-15(3)12-18-17(4,5)6/h8-11,15,18H,7,12-13H2,1-6H3 |
| InChIKey | AQQXUZPVTSOQBD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|