C15H25N — CID 62530089
N-tert-butyl-2-methyl-3-(4-methylphenyl)propan-1-amine (PubChem CID 62530089) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-3-(4-methylphenyl)propan-1-amine.
| Compound Name | N-tert-butyl-2-methyl-3-(4-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 62530089 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-tert-butyl-2-methyl-3-(4-methylphenyl)propan-1-amine |
| SMILES | Cc1ccc(CC(C)CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25N/c1-12-6-8-14(9-7-12)10-13(2)11-16-15(3,4)5/h6-9,13,16H,10-11H2,1-5H3 |
| InChIKey | MCTXUFDRHYPKBH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |