C15H25NO — CID 66453264
4-(N-ethyl-4-methylanilino)-3,3-dimethylbutan-2-ol (PubChem CID 66453264) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-(N-ethyl-4-methylanilino)-3,3-dimethylbutan-2-ol.
| Compound Name | 4-(N-ethyl-4-methylanilino)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 66453264 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-(N-ethyl-4-methylanilino)-3,3-dimethylbutan-2-ol |
| SMILES | CCN(CC(C)(C)C(C)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H25NO/c1-6-16(11-15(4,5)13(3)17)14-9-7-12(2)8-10-14/h7-10,13,17H,6,11H2,1-5H3 |
| InChIKey | XMGJAUQWHQHMOI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|